C21H20FNO2S — CID 59621337
2-[(4aS,5R,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone (PubChem CID 59621337) has the molecular formula C21H20FNO2S and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-[(4aS,5R,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[(4aS,5R,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 59621337 |
| Molecular Formula | C21H20FNO2S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[(4aS,5R,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]-1-phenylethanone |
| SMILES | C[C@H]1OC[C@]2(c3ccccc3F)N=C(CC(=O)c3ccccc3)SC[C@H]12 |
| InChI | InChI=1S/C21H20FNO2S/c1-14-17-12-26-20(11-19(24)15-7-3-2-4-8-15)23-21(17,13-25-14)16-9-5-6-10-18(16)22/h2-10,14,17H,11-13H2,1H3/t14-,17-,21-/m1/s1 |
| InChIKey | QJALEXKBLPHHTL-SOIKWTOOSA-N |
| XLogP | 4.47 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |