C14H20FNO2 — CID 59621338
[(3R,4S,6S)-4-amino-6-ethyl-4-(2-fluorophenyl)oxan-3-yl]methanol (PubChem CID 59621338) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is [(3R,4S,6S)-4-amino-6-ethyl-4-(2-fluorophenyl)oxan-3-yl]methanol.
| Compound Name | [(3R,4S,6S)-4-amino-6-ethyl-4-(2-fluorophenyl)oxan-3-yl]methanol |
|---|---|
| PubChem CID | 59621338 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | [(3R,4S,6S)-4-amino-6-ethyl-4-(2-fluorophenyl)oxan-3-yl]methanol |
| SMILES | CC[C@H]1C[C@@](N)(c2ccccc2F)[C@H](CO)CO1 |
| InChI | InChI=1S/C14H20FNO2/c1-2-11-7-14(16,10(8-17)9-18-11)12-5-3-4-6-13(12)15/h3-6,10-11,17H,2,7-9,16H2,1H3/t10-,11+,14+/m1/s1 |
| InChIKey | XOCVJBVBGRQBJB-SUNKGSAMSA-N |
| XLogP | 1.79 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |