C16H22F7NO2 — CID 596218
(1,2,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydroquinolin-4-yl) 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 596218) has the molecular formula C16H22F7NO2 and a molecular weight of 393.34 g/mol. Its IUPAC name is (1,2,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydroquinolin-4-yl) 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (1,2,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydroquinolin-4-yl) 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 596218 |
| Molecular Formula | C16H22F7NO2 |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (1,2,8a-trimethyl-2,3,4,4a,5,6,7,8-octahydroquinolin-4-yl) 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | CC1CC(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C2CCCCC2(C)N1C |
| InChI | InChI=1S/C16H22F7NO2/c1-9-8-11(10-6-4-5-7-13(10,2)24(9)3)26-12(25)14(17,18)15(19,20)16(21,22)23/h9-11H,4-8H2,1-3H3 |
| InChIKey | WAMAPXFNRYANFY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|