About CID 59621930
CID 59621930 (PubChem CID 59621930) has the molecular formula C19H10IrN-
and a molecular weight of 444.51 g/mol.
Molecular Properties
| Compound Name | CID 59621930 |
| PubChem CID | 59621930 |
| Molecular Formula | C19H10IrN- |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1cccc2ccc3c4c5c(cccc5nc3c12)C=C4 |
| InChI | InChI=1S/C19H10N.Ir/c1-2-6-14-12(4-1)8-11-16-15-10-9-13-5-3-7-17(18(13)15)20-19(14)16;/h1-5,7-11H;/q-1; |
| InChIKey | VNUHUESGXGYLSC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 59621930 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59621930?
The IUPAC name of CID 59621930 (CID 59621930) is not available.
What is the SMILES notation for CID 59621930?
The canonical SMILES for CID 59621930 is [Ir].[c-]1cccc2ccc3c4c5c(cccc5nc3c12)C=C4.
What is the InChIKey of CID 59621930?
The InChIKey is VNUHUESGXGYLSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H10N.Ir/c1-2-6-14-12(4-1)8-11-16-15-10-9-13-5-3-7-17(18(13)15)20-19(14)16;/h1-5,7-11H;/q-1;.
What are the key properties of CID 59621930?
CID 59621930 has a molecular weight of 444.51 g/mol, XLogP of 4.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59621930 is sourced from PubChem (CID 59621930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).