C29H17IrN2O2S- — CID 59622119
6-(3H-dibenzothiophen-3-id-4-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium;pyridine-2-carboxylic acid (PubChem CID 59622119) has the molecular formula C29H17IrN2O2S- and a molecular weight of 649.75 g/mol. Its IUPAC name is 6-(3H-dibenzothiophen-3-id-4-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium;pyridine-2-carboxylic acid.
| Compound Name | 6-(3H-dibenzothiophen-3-id-4-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium;pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 59622119 |
| Molecular Formula | C29H17IrN2O2S- |
| Molecular Weight | 649.75 g/mol |
| Exact Mass | 650.06 |
| IUPAC Name | 6-(3H-dibenzothiophen-3-id-4-yl)-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene;iridium;pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccccn1.[Ir].[c-]1ccc2c(sc3ccccc32)c1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C23H12NS.C6H5NO2.Ir/c1-2-10-21-16(6-1)17-7-4-8-18(23(17)25-21)20-13-15-12-11-14-5-3-9-19(24-20)22(14)15;8-6(9)5-3-1-2-4-7-5;/h1-7,9-13H;1-4H,(H,8,9);/q-1;; |
| InChIKey | VQTVEULQGGFLEY-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.75 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|