C16H46O10RfSi8-2 — CID 59622479
bis(2-(3-methanidyloxypropyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane);rutherfordium (PubChem CID 59622479) has the molecular formula C16H46O10RfSi8-2 and a molecular weight of 890.22 g/mol. Its IUPAC name is bis(2-(3-methanidyloxypropyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane);rutherfordium.
| Compound Name | bis(2-(3-methanidyloxypropyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane);rutherfordium |
|---|---|
| PubChem CID | 59622479 |
| Molecular Formula | C16H46O10RfSi8-2 |
| Molecular Weight | 890.22 g/mol |
| Exact Mass | 889.25 |
| IUPAC Name | bis(2-(3-methanidyloxypropyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane);rutherfordium |
| SMILES | [CH2-]OCCC[Si]1(C)O[SiH](C)O[SiH](C)O[SiH](C)O1.[CH2-]OCCC[Si]1(C)O[SiH](C)O[SiH](C)O[SiH](C)O1.[Rf] |
| InChI | InChI=1S/2C8H23O5Si4.Rf/c2*1-9-7-6-8-17(5)12-15(3)10-14(2)11-16(4)13-17;/h2*14-16H,1,6-8H2,2-5H3;/q2*-1; |
| InChIKey | GZIGDKXSNCQURF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|