C8H24O5Si4 — CID 59622480
2-(3-methoxypropyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 59622480) has the molecular formula C8H24O5Si4 and a molecular weight of 312.62 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-(3-methoxypropyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 59622480 |
| Molecular Formula | C8H24O5Si4 |
| Molecular Weight | 312.62 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-(3-methoxypropyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | COCCC[Si]1(C)O[SiH](C)O[SiH](C)O[SiH](C)O1 |
| InChI | InChI=1S/C8H24O5Si4/c1-9-7-6-8-17(5)12-15(3)10-14(2)11-16(4)13-17/h14-16H,6-8H2,1-5H3 |
| InChIKey | JLQPFUIFVHCSIW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.62 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|