About (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate
(5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate (PubChem CID 59623057) has the molecular formula C11H14O8S
and a molecular weight of 306.29 g/mol. Its IUPAC name is (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate.
Molecular Properties
| Compound Name | (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate |
| PubChem CID | 59623057 |
| Molecular Formula | C11H14O8S |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate |
| SMILES | O=C(CCSOOO)OC1CC2OC1C1C(=O)OCC21 |
| InChI | InChI=1S/C11H14O8S/c12-8(1-2-20-19-18-14)16-7-3-6-5-4-15-11(13)9(5)10(7)17-6/h5-7,9-10,14H,1-4H2 |
| InChIKey | OEMSXYYBCYNWKJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate?
The IUPAC name of (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate (CID 59623057) is (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate.
What is the SMILES notation for (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate?
The canonical SMILES for (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate is O=C(CCSOOO)OC1CC2OC1C1C(=O)OCC21.
What is the InChIKey of (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate?
The InChIKey is OEMSXYYBCYNWKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O8S/c12-8(1-2-20-19-18-14)16-7-3-6-5-4-15-11(13)9(5)10(7)17-6/h5-7,9-10,14H,1-4H2.
What are the key properties of (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate?
(5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate has a molecular weight of 306.29 g/mol, XLogP of 0.32, 6 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (5-oxo-4,10-dioxatricyclo[5.2.1.02,6]decan-8-yl) 3-(trioxidanylsulfanyl)propanoate is sourced from PubChem (CID 59623057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).