C13H13BrF4O5 — CID 59623058
(4-bromo-3,3,4,4-tetrafluorobutyl) 2-hydroxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 59623058) has the molecular formula C13H13BrF4O5 and a molecular weight of 405.14 g/mol. Its IUPAC name is (4-bromo-3,3,4,4-tetrafluorobutyl) 2-hydroxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (4-bromo-3,3,4,4-tetrafluorobutyl) 2-hydroxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 59623058 |
| Molecular Formula | C13H13BrF4O5 |
| Molecular Weight | 405.14 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | (4-bromo-3,3,4,4-tetrafluorobutyl) 2-hydroxy-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)Br)C1C2CC3C(OC(=O)C31)C2O |
| InChI | InChI=1S/C13H13BrF4O5/c14-13(17,18)12(15,16)1-2-22-10(20)6-4-3-5-7(6)11(21)23-9(5)8(4)19/h4-9,19H,1-3H2 |
| InChIKey | MWVOMQBWZBPILF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.14 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|