C11H13F2O9S2- — CID 59623156
(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate (PubChem CID 59623156) has the molecular formula C11H13F2O9S2- and a molecular weight of 391.35 g/mol. Its IUPAC name is (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate.
| Compound Name | (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate |
|---|---|
| PubChem CID | 59623156 |
| Molecular Formula | C11H13F2O9S2- |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | (1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) 2,2-difluoro-2-oxidoperoxysulfanylacetate |
| SMILES | CC1C2(C)OC3C(C2OC(=O)C(F)(F)SOO[O-])S(=O)(=O)OC31C |
| InChI | InChI=1S/C11H14F2O9S2/c1-4-9(2)6(18-8(14)11(12,13)23-22-21-15)5-7(19-9)10(4,3)20-24(5,16)17/h4-7,15H,1-3H3/p-1 |
| InChIKey | XADUWZHCVDAWQB-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 120.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|