C11H13F2O8S2- — CID 59623272
(2,2-difluoro-2-oxidoperoxysulfanylethyl) 3-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 59623272) has the molecular formula C11H13F2O8S2- and a molecular weight of 375.35 g/mol. Its IUPAC name is (2,2-difluoro-2-oxidoperoxysulfanylethyl) 3-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | (2,2-difluoro-2-oxidoperoxysulfanylethyl) 3-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 59623272 |
| Molecular Formula | C11H13F2O8S2- |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | (2,2-difluoro-2-oxidoperoxysulfanylethyl) 3-methyl-5,5-dioxo-4-oxa-5λ6-thiatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CC12CC3CC1C(C3C(=O)OCC(F)(F)SOO[O-])S(=O)(=O)O2 |
| InChI | InChI=1S/C11H14F2O8S2/c1-10-3-5-2-6(10)8(23(16,17)19-10)7(5)9(14)18-4-11(12,13)22-21-20-15/h5-8,15H,2-4H2,1H3/p-1 |
| InChIKey | ZVRZQKHJURSGGR-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|