About methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate
methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate (PubChem CID 59623733) has the molecular formula C13H10ClF2N3O4S
and a molecular weight of 377.76 g/mol. Its IUPAC name is methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate |
| PubChem CID | 59623733 |
| Molecular Formula | C13H10ClF2N3O4S |
| Molecular Weight | 377.76 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nccnc1NS(=O)(=O)Cc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C13H10ClF2N3O4S/c1-23-13(20)11-12(18-5-4-17-11)19-24(21,22)6-7-8(15)2-3-9(16)10(7)14/h2-5H,6H2,1H3,(H,18,19) |
| InChIKey | NBXCJXZVAVQJOW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate?
The IUPAC name of methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate (CID 59623733) is methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate.
What is the SMILES notation for methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate?
The canonical SMILES for methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate is COC(=O)c1nccnc1NS(=O)(=O)Cc1c(F)ccc(F)c1Cl.
What is the InChIKey of methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate?
The InChIKey is NBXCJXZVAVQJOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClF2N3O4S/c1-23-13(20)11-12(18-5-4-17-11)19-24(21,22)6-7-8(15)2-3-9(16)10(7)14/h2-5H,6H2,1H3,(H,18,19).
What are the key properties of methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate?
methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate has a molecular weight of 377.76 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2-chloro-3,6-difluorophenyl)methylsulfonylamino]pyrazine-2-carboxylate is sourced from PubChem (CID 59623733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).