About methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate
methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate (PubChem CID 59623759) has the molecular formula C11H13F2N3O6S
and a molecular weight of 353.30 g/mol. Its IUPAC name is methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate |
| PubChem CID | 59623759 |
| Molecular Formula | C11H13F2N3O6S |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)CS(=O)(=O)N(CC(F)F)c1nccnc1C(=O)OC |
| InChI | InChI=1S/C11H13F2N3O6S/c1-21-8(17)6-23(19,20)16(5-7(12)13)10-9(11(18)22-2)14-3-4-15-10/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | DHZMZPKGXGLKJS-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 115.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate?
The IUPAC name of methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate (CID 59623759) is methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate.
What is the SMILES notation for methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate?
The canonical SMILES for methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate is COC(=O)CS(=O)(=O)N(CC(F)F)c1nccnc1C(=O)OC.
What is the InChIKey of methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate?
The InChIKey is DHZMZPKGXGLKJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N3O6S/c1-21-8(17)6-23(19,20)16(5-7(12)13)10-9(11(18)22-2)14-3-4-15-10/h3-4,7H,5-6H2,1-2H3.
What are the key properties of methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate?
methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate has a molecular weight of 353.30 g/mol, XLogP of -0.16, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2,2-difluoroethyl-(2-methoxy-2-oxoethyl)sulfonylamino]pyrazine-2-carboxylate is sourced from PubChem (CID 59623759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).