C27H40N2O3 — CID 59624154
[(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2,5-diamino-5-oxopentanoate (PubChem CID 59624154) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2,5-diamino-5-oxopentanoate.
| Compound Name | [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2,5-diamino-5-oxopentanoate |
|---|---|
| PubChem CID | 59624154 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | [(11aR,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2,5-diamino-5-oxopentanoate |
| SMILES | Cc1cc(OC(=O)C(N)CCC(N)=O)cc2c1C1(C)CCC3C(C)(C)CCC[C@]3(C)[C@H]1C2 |
| InChI | InChI=1S/C27H40N2O3/c1-16-13-18(32-24(31)19(28)7-8-22(29)30)14-17-15-21-26(4)11-6-10-25(2,3)20(26)9-12-27(21,5)23(16)17/h13-14,19-21H,6-12,15,28H2,1-5H3,(H2,29,30)/t19?,20?,21-,26+,27?/m1/s1 |
| InChIKey | FBEFFIQDXCKAKS-RGNZYHDPSA-N |
| XLogP | 4.55 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|