C31H43NO7 — CID 59624189
4-[[(11aR,11bS)-4,4,6a,7,8,10,11b-heptamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl]oxy]-3-[(2-carboxyacetyl)amino]-4-oxobutanoic acid (PubChem CID 59624189) has the molecular formula C31H43NO7 and a molecular weight of 541.69 g/mol. Its IUPAC name is 4-[[(11aR,11bS)-4,4,6a,7,8,10,11b-heptamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl]oxy]-3-[(2-carboxyacetyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(11aR,11bS)-4,4,6a,7,8,10,11b-heptamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl]oxy]-3-[(2-carboxyacetyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 59624189 |
| Molecular Formula | C31H43NO7 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | 4-[[(11aR,11bS)-4,4,6a,7,8,10,11b-heptamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl]oxy]-3-[(2-carboxyacetyl)amino]-4-oxobutanoic acid |
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)C(CC(=O)O)NC(=O)CC(=O)O)C[C@H]1C2(C)CCC2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C31H43NO7/c1-16-17(2)27(39-28(38)20(14-24(34)35)32-23(33)15-25(36)37)18(3)19-13-22-30(6)11-8-10-29(4,5)21(30)9-12-31(22,7)26(16)19/h20-22H,8-15H2,1-7H3,(H,32,33)(H,34,35)(H,36,37)/t20?,21?,22-,30+,31?/m1/s1 |
| InChIKey | IGPGSGWEMFWVCN-DRVUGQHTSA-N |
| XLogP | 5.01 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|