C30H46O5S — CID 59624277
[(4aS,6aR,11aS,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfanyl]acetate (PubChem CID 59624277) has the molecular formula C30H46O5S and a molecular weight of 518.76 g/mol. Its IUPAC name is [(4aS,6aR,11aS,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfanyl]acetate.
| Compound Name | [(4aS,6aR,11aS,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfanyl]acetate |
|---|---|
| PubChem CID | 59624277 |
| Molecular Formula | C30H46O5S |
| Molecular Weight | 518.76 g/mol |
| Exact Mass | 518.31 |
| IUPAC Name | [(4aS,6aR,11aS,11bS)-4,4,6a,7,11b-pentamethyl-1,2,3,4a,5,6,11,11a-octahydrobenzo[a]fluoren-9-yl] 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethylsulfanyl]acetate |
| SMILES | Cc1cc(OC(=O)CSCCOCCOCCO)cc2c1[C@]1(C)CC[C@H]3C(C)(C)CCC[C@]3(C)[C@@H]1C2 |
| InChI | InChI=1S/C30H46O5S/c1-21-17-23(35-26(32)20-36-16-15-34-14-13-33-12-11-31)18-22-19-25-29(4)9-6-8-28(2,3)24(29)7-10-30(25,5)27(21)22/h17-18,24-25,31H,6-16,19-20H2,1-5H3/t24-,25-,29-,30+/m0/s1 |
| InChIKey | QCBPGHZJFQFURG-HWUWQJTLSA-N |
| XLogP | 5.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.76 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|