C27H34FN7O2 — CID 59624344
8-(cyclopropylamino)-N-(2-fluoro-4-pyridinyl)-6-[[4-(4-methyl-2-oxopentyl)cyclohexyl]amino]imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 59624344) has the molecular formula C27H34FN7O2 and a molecular weight of 507.61 g/mol. Its IUPAC name is 8-(cyclopropylamino)-N-(2-fluoro-4-pyridinyl)-6-[[4-(4-methyl-2-oxopentyl)cyclohexyl]amino]imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 8-(cyclopropylamino)-N-(2-fluoro-4-pyridinyl)-6-[[4-(4-methyl-2-oxopentyl)cyclohexyl]amino]imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 59624344 |
| Molecular Formula | C27H34FN7O2 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 8-(cyclopropylamino)-N-(2-fluoro-4-pyridinyl)-6-[[4-(4-methyl-2-oxopentyl)cyclohexyl]amino]imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | CC(C)CC(=O)CC1CCC(Nc2cc(NC3CC3)c3ncc(C(=O)Nc4ccnc(F)c4)n3n2)CC1 |
| InChI | InChI=1S/C27H34FN7O2/c1-16(2)11-21(36)12-17-3-5-19(6-4-17)32-25-14-22(31-18-7-8-18)26-30-15-23(35(26)34-25)27(37)33-20-9-10-29-24(28)13-20/h9-10,13-19,31H,3-8,11-12H2,1-2H3,(H,32,34)(H,29,33,37) |
| InChIKey | BXGZOSHQYJDXBO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|