C29H33FN8O2 — CID 59624636
6-[(4-aminocyclohexyl)amino]-8-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-N-(2-fluoro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 59624636) has the molecular formula C29H33FN8O2 and a molecular weight of 544.64 g/mol. Its IUPAC name is 6-[(4-aminocyclohexyl)amino]-8-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-N-(2-fluoro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-[(4-aminocyclohexyl)amino]-8-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-N-(2-fluoro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 59624636 |
| Molecular Formula | C29H33FN8O2 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 6-[(4-aminocyclohexyl)amino]-8-[cyclopropyl-[(4-methoxyphenyl)methyl]amino]-N-(2-fluoro-4-pyridinyl)imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | COc1ccc(CN(c2cc(NC3CCC(N)CC3)nn3c(C(=O)Nc4ccnc(F)c4)cnc23)C2CC2)cc1 |
| InChI | InChI=1S/C29H33FN8O2/c1-40-23-10-2-18(3-11-23)17-37(22-8-9-22)24-15-27(34-20-6-4-19(31)5-7-20)36-38-25(16-33-28(24)38)29(39)35-21-12-13-32-26(30)14-21/h2-3,10-16,19-20,22H,4-9,17,31H2,1H3,(H,34,36)(H,32,35,39) |
| InChIKey | NAEANMIPQDLXAL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|