About tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate
tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate (PubChem CID 59625268) has the molecular formula C20H38N2O3
and a molecular weight of 354.54 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate |
| PubChem CID | 59625268 |
| Molecular Formula | C20H38N2O3 |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate |
| SMILES | CC(C)CN[C@H]1C[C@@H](C2(O)CCCCC2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H38N2O3/c1-15(2)12-21-17-11-16(20(24)9-7-6-8-10-20)13-22(14-17)18(23)25-19(3,4)5/h15-17,21,24H,6-14H2,1-5H3/t16-,17+/m1/s1 |
| InChIKey | SNXWOWCQDXTPBK-SJORKVTESA-N |
| XLogP | 3.55 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate?
The IUPAC name of tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate (CID 59625268) is tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate is CC(C)CN[C@H]1C[C@@H](C2(O)CCCCC2)CN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate?
The InChIKey is SNXWOWCQDXTPBK-SJORKVTESA-N. The full InChI is InChI=1S/C20H38N2O3/c1-15(2)12-21-17-11-16(20(24)9-7-6-8-10-20)13-22(14-17)18(23)25-19(3,4)5/h15-17,21,24H,6-14H2,1-5H3/t16-,17+/m1/s1.
What are the key properties of tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate?
tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate has a molecular weight of 354.54 g/mol, XLogP of 3.55, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R,5S)-3-(1-hydroxycyclohexyl)-5-(2-methylpropylamino)piperidine-1-carboxylate is sourced from PubChem (CID 59625268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).