C25H34N4O6 — CID 59625346
tert-butyl (3R,5S)-3-(4-ethoxycarbonyl-1-methylpyrazol-5-yl)-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate (PubChem CID 59625346) has the molecular formula C25H34N4O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3-(4-ethoxycarbonyl-1-methylpyrazol-5-yl)-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R,5S)-3-(4-ethoxycarbonyl-1-methylpyrazol-5-yl)-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59625346 |
| Molecular Formula | C25H34N4O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | tert-butyl (3R,5S)-3-(4-ethoxycarbonyl-1-methylpyrazol-5-yl)-5-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)c1cnn(C)c1[C@@H]1C[C@H](NC(=O)OCc2ccccc2)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C25H34N4O6/c1-6-33-22(30)20-13-26-28(5)21(20)18-12-19(15-29(14-18)24(32)35-25(2,3)4)27-23(31)34-16-17-10-8-7-9-11-17/h7-11,13,18-19H,6,12,14-16H2,1-5H3,(H,27,31)/t18-,19+/m1/s1 |
| InChIKey | QJMSJAOSCKILAW-MOPGFXCFSA-N |
| XLogP | 3.62 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|