C15H22F3N5O2 — CID 59625384
(4-aminopiperidin-1-yl)-[4-(3-methoxypropylamino)-2-(trifluoromethyl)pyrimidin-5-yl]methanone (PubChem CID 59625384) has the molecular formula C15H22F3N5O2 and a molecular weight of 361.37 g/mol. Its IUPAC name is (4-aminopiperidin-1-yl)-[4-(3-methoxypropylamino)-2-(trifluoromethyl)pyrimidin-5-yl]methanone.
| Compound Name | (4-aminopiperidin-1-yl)-[4-(3-methoxypropylamino)-2-(trifluoromethyl)pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 59625384 |
| Molecular Formula | C15H22F3N5O2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (4-aminopiperidin-1-yl)-[4-(3-methoxypropylamino)-2-(trifluoromethyl)pyrimidin-5-yl]methanone |
| SMILES | COCCCNc1nc(C(F)(F)F)ncc1C(=O)N1CCC(N)CC1 |
| InChI | InChI=1S/C15H22F3N5O2/c1-25-8-2-5-20-12-11(9-21-14(22-12)15(16,17)18)13(24)23-6-3-10(19)4-7-23/h9-10H,2-8,19H2,1H3,(H,20,21,22) |
| InChIKey | HCKJMANVVTXKDQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|