About 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline
8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline (PubChem CID 59626583) has the molecular formula C20H22N2OS
and a molecular weight of 338.48 g/mol. Its IUPAC name is 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline.
Molecular Properties
| Compound Name | 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline |
| PubChem CID | 59626583 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline |
| SMILES | COc1cc2c(cc1CC(C)C)-c1c(-c3cccs3)ncn1CC2 |
| InChI | InChI=1S/C20H22N2OS/c1-13(2)9-15-10-16-14(11-17(15)23-3)6-7-22-12-21-19(20(16)22)18-5-4-8-24-18/h4-5,8,10-13H,6-7,9H2,1-3H3 |
| InChIKey | QUDCSAUQUYSLIU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline?
The IUPAC name of 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline (CID 59626583) is 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline.
What is the SMILES notation for 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline?
The canonical SMILES for 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline is COc1cc2c(cc1CC(C)C)-c1c(-c3cccs3)ncn1CC2.
What is the InChIKey of 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline?
The InChIKey is QUDCSAUQUYSLIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2OS/c1-13(2)9-15-10-16-14(11-17(15)23-3)6-7-22-12-21-19(20(16)22)18-5-4-8-24-18/h4-5,8,10-13H,6-7,9H2,1-3H3.
What are the key properties of 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline?
8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline has a molecular weight of 338.48 g/mol, XLogP of 5.04, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline is sourced from PubChem (CID 59626583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).