C40H40N4O2SSi — CID 59626600
N-tert-butyl-8-methoxy-N-methyl-1-thiophen-2-yl-9-(triphenylsilylamino)-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxamide (PubChem CID 59626600) has the molecular formula C40H40N4O2SSi and a molecular weight of 668.94 g/mol. Its IUPAC name is N-tert-butyl-8-methoxy-N-methyl-1-thiophen-2-yl-9-(triphenylsilylamino)-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxamide.
| Compound Name | N-tert-butyl-8-methoxy-N-methyl-1-thiophen-2-yl-9-(triphenylsilylamino)-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 59626600 |
| Molecular Formula | C40H40N4O2SSi |
| Molecular Weight | 668.94 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | N-tert-butyl-8-methoxy-N-methyl-1-thiophen-2-yl-9-(triphenylsilylamino)-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxamide |
| SMILES | COc1cc2c(cc1N[Si](c1ccccc1)(c1ccccc1)c1ccccc1)-c1c(-c3cccs3)nc(C(=O)N(C)C(C)(C)C)n1CC2 |
| InChI | InChI=1S/C40H40N4O2SSi/c1-40(2,3)43(4)39(45)38-41-36(35-22-15-25-47-35)37-32-27-33(34(46-5)26-28(32)23-24-44(37)38)42-48(29-16-9-6-10-17-29,30-18-11-7-12-19-30)31-20-13-8-14-21-31/h6-22,25-27,42H,23-24H2,1-5H3 |
| InChIKey | XWEWUQGZWDQXNE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.94 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|