C31H64O3Si2 — CID 59627887
(3S,6R,7S,8S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,7,8,12-hexamethyltridec-12-en-5-one (PubChem CID 59627887) has the molecular formula C31H64O3Si2 and a molecular weight of 541.02 g/mol. Its IUPAC name is (3S,6R,7S,8S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,7,8,12-hexamethyltridec-12-en-5-one.
| Compound Name | (3S,6R,7S,8S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,7,8,12-hexamethyltridec-12-en-5-one |
|---|---|
| PubChem CID | 59627887 |
| Molecular Formula | C31H64O3Si2 |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.44 |
| IUPAC Name | (3S,6R,7S,8S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,7,8,12-hexamethyltridec-12-en-5-one |
| SMILES | C=C(C)CCC[C@H](C)[C@H](C)[C@@H](C)C(=O)C(C)(C)[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H64O3Si2/c1-23(2)19-18-20-24(3)25(4)26(5)28(32)31(12,13)27(34-36(16,17)30(9,10)11)21-22-33-35(14,15)29(6,7)8/h24-27H,1,18-22H2,2-17H3/t24-,25-,26+,27-/m0/s1 |
| InChIKey | RTBUZNWYHUXVHK-NFGXINMFSA-N |
| XLogP | 10.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|