C10H7F13O2 — CID 59628153
2-ethyl-4,4,5,6,6-pentafluoro-5-(1,1,2,2,3-pentafluoropropyl)-2-(trifluoromethyl)-1,3-dioxane (PubChem CID 59628153) has the molecular formula C10H7F13O2 and a molecular weight of 406.14 g/mol. Its IUPAC name is 2-ethyl-4,4,5,6,6-pentafluoro-5-(1,1,2,2,3-pentafluoropropyl)-2-(trifluoromethyl)-1,3-dioxane.
| Compound Name | 2-ethyl-4,4,5,6,6-pentafluoro-5-(1,1,2,2,3-pentafluoropropyl)-2-(trifluoromethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 59628153 |
| Molecular Formula | C10H7F13O2 |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | 2-ethyl-4,4,5,6,6-pentafluoro-5-(1,1,2,2,3-pentafluoropropyl)-2-(trifluoromethyl)-1,3-dioxane |
| SMILES | CCC1(C(F)(F)F)OC(F)(F)C(F)(C(F)(F)C(F)(F)CF)C(F)(F)O1 |
| InChI | InChI=1S/C10H7F13O2/c1-2-5(8(17,18)19)24-9(20,21)6(14,10(22,23)25-5)7(15,16)4(12,13)3-11/h2-3H2,1H3 |
| InChIKey | HPZRNULDIUVTER-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|