C10H12F8O4 — CID 59628186
[1,2,2,3,4,5,5,6-octafluoro-3,4,6-tris(hydroxymethyl)cyclohexyl]methanol (PubChem CID 59628186) has the molecular formula C10H12F8O4 and a molecular weight of 348.19 g/mol. Its IUPAC name is [1,2,2,3,4,5,5,6-octafluoro-3,4,6-tris(hydroxymethyl)cyclohexyl]methanol.
| Compound Name | [1,2,2,3,4,5,5,6-octafluoro-3,4,6-tris(hydroxymethyl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 59628186 |
| Molecular Formula | C10H12F8O4 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | [1,2,2,3,4,5,5,6-octafluoro-3,4,6-tris(hydroxymethyl)cyclohexyl]methanol |
| SMILES | OCC1(F)C(F)(F)C(F)(CO)C(F)(CO)C(F)(F)C1(F)CO |
| InChI | InChI=1S/C10H12F8O4/c11-5(1-19)6(12,2-20)10(17,18)8(14,4-22)7(13,3-21)9(5,15)16/h19-22H,1-4H2 |
| InChIKey | RZYGSRVCDTVPGG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |