C15H9F21O4 — CID 59628189
3-[[3-[difluoro-(1,1,2,2-tetrafluoro-3-hydroxypropoxy)methyl]-1,2,2,3,4,4,5,6,6-nonafluoro-5-methylcyclohexyl]-difluoromethoxy]-2,2,3,3-tetrafluoropropan-1-ol (PubChem CID 59628189) has the molecular formula C15H9F21O4 and a molecular weight of 652.19 g/mol. Its IUPAC name is 3-[[3-[difluoro-(1,1,2,2-tetrafluoro-3-hydroxypropoxy)methyl]-1,2,2,3,4,4,5,6,6-nonafluoro-5-methylcyclohexyl]-difluoromethoxy]-2,2,3,3-tetrafluoropropan-1-ol.
| Compound Name | 3-[[3-[difluoro-(1,1,2,2-tetrafluoro-3-hydroxypropoxy)methyl]-1,2,2,3,4,4,5,6,6-nonafluoro-5-methylcyclohexyl]-difluoromethoxy]-2,2,3,3-tetrafluoropropan-1-ol |
|---|---|
| PubChem CID | 59628189 |
| Molecular Formula | C15H9F21O4 |
| Molecular Weight | 652.19 g/mol |
| Exact Mass | 652.02 |
| IUPAC Name | 3-[[3-[difluoro-(1,1,2,2-tetrafluoro-3-hydroxypropoxy)methyl]-1,2,2,3,4,4,5,6,6-nonafluoro-5-methylcyclohexyl]-difluoromethoxy]-2,2,3,3-tetrafluoropropan-1-ol |
| SMILES | CC1(F)C(F)(F)C(F)(C(F)(F)OC(F)(F)C(F)(F)CO)C(F)(F)C(F)(C(F)(F)OC(F)(F)C(F)(F)CO)C1(F)F |
| InChI | InChI=1S/C15H9F21O4/c1-4(16)9(23,24)7(21,14(33,34)39-12(29,30)5(17,18)2-37)11(27,28)8(22,10(4,25)26)15(35,36)40-13(31,32)6(19,20)3-38/h37-38H,2-3H2,1H3 |
| InChIKey | VYYRHANWCUVZTA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.19 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|