C11H22O2S — CID 59628307
(2R,3S,4R,5S)-3-ethoxy-2-(ethoxymethyl)-4,5-dimethylthiolane (PubChem CID 59628307) has the molecular formula C11H22O2S and a molecular weight of 218.36 g/mol. Its IUPAC name is (2R,3S,4R,5S)-3-ethoxy-2-(ethoxymethyl)-4,5-dimethylthiolane.
| Compound Name | (2R,3S,4R,5S)-3-ethoxy-2-(ethoxymethyl)-4,5-dimethylthiolane |
|---|---|
| PubChem CID | 59628307 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2R,3S,4R,5S)-3-ethoxy-2-(ethoxymethyl)-4,5-dimethylthiolane |
| SMILES | CCOC[C@H]1S[C@@H](C)[C@H](C)[C@@H]1OCC |
| InChI | InChI=1S/C11H22O2S/c1-5-12-7-10-11(13-6-2)8(3)9(4)14-10/h8-11H,5-7H2,1-4H3/t8-,9-,10+,11-/m0/s1 |
| InChIKey | NQIUTERFPWJONO-MMWGEVLESA-N |
| XLogP | 2.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |