About (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine
(2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine (PubChem CID 59628636) has the molecular formula C22H29N
and a molecular weight of 307.48 g/mol. Its IUPAC name is (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine.
Molecular Properties
| Compound Name | (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine |
| PubChem CID | 59628636 |
| Molecular Formula | C22H29N |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine |
| SMILES | CCc1ccc(C(C)(c2ccc(CC)cc2)[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C22H29N/c1-4-17-8-12-19(13-9-17)22(3,21-7-6-16-23-21)20-14-10-18(5-2)11-15-20/h8-15,21,23H,4-7,16H2,1-3H3/t21-/m0/s1 |
| InChIKey | YHXFXTHNUNFMOJ-NRFANRHFSA-N |
| XLogP | 4.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine?
The IUPAC name of (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine (CID 59628636) is (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine.
What is the SMILES notation for (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine?
The canonical SMILES for (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine is CCc1ccc(C(C)(c2ccc(CC)cc2)[C@@H]2CCCN2)cc1.
What is the InChIKey of (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine?
The InChIKey is YHXFXTHNUNFMOJ-NRFANRHFSA-N. The full InChI is InChI=1S/C22H29N/c1-4-17-8-12-19(13-9-17)22(3,21-7-6-16-23-21)20-14-10-18(5-2)11-15-20/h8-15,21,23H,4-7,16H2,1-3H3/t21-/m0/s1.
What are the key properties of (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine?
(2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine has a molecular weight of 307.48 g/mol, XLogP of 4.87, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[1,1-bis(4-ethylphenyl)ethyl]pyrrolidine is sourced from PubChem (CID 59628636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).