About (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine
(4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine (PubChem CID 59628826) has the molecular formula C28H41NS
and a molecular weight of 423.71 g/mol. Its IUPAC name is (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine.
Molecular Properties
| Compound Name | (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine |
| PubChem CID | 59628826 |
| Molecular Formula | C28H41NS |
| Molecular Weight | 423.71 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine |
| SMILES | CC(C)C(C)(C)c1ccc(C(c2ccc(C(C)(C)C(C)C)cc2)[C@@H]2CSCN2)cc1 |
| InChI | InChI=1S/C28H41NS/c1-19(2)27(5,6)23-13-9-21(10-14-23)26(25-17-30-18-29-25)22-11-15-24(16-12-22)28(7,8)20(3)4/h9-16,19-20,25-26,29H,17-18H2,1-8H3/t25-/m0/s1 |
| InChIKey | ALSVPUFXCBPVRX-VWLOTQADSA-N |
| XLogP | 7.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.71 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine?
The IUPAC name of (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine (CID 59628826) is (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine.
What is the SMILES notation for (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine?
The canonical SMILES for (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine is CC(C)C(C)(C)c1ccc(C(c2ccc(C(C)(C)C(C)C)cc2)[C@@H]2CSCN2)cc1.
What is the InChIKey of (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine?
The InChIKey is ALSVPUFXCBPVRX-VWLOTQADSA-N. The full InChI is InChI=1S/C28H41NS/c1-19(2)27(5,6)23-13-9-21(10-14-23)26(25-17-30-18-29-25)22-11-15-24(16-12-22)28(7,8)20(3)4/h9-16,19-20,25-26,29H,17-18H2,1-8H3/t25-/m0/s1.
What are the key properties of (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine?
(4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine has a molecular weight of 423.71 g/mol, XLogP of 7.35, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-[bis[4-(2,3-dimethylbutan-2-yl)phenyl]methyl]-1,3-thiazolidine is sourced from PubChem (CID 59628826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).