C34H24N2 — CID 59629353
2-(3-phenylphenyl)-5-[6-(3-phenylphenyl)-3-pyridinyl]pyridine (PubChem CID 59629353) has the molecular formula C34H24N2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-(3-phenylphenyl)-5-[6-(3-phenylphenyl)-3-pyridinyl]pyridine.
| Compound Name | 2-(3-phenylphenyl)-5-[6-(3-phenylphenyl)-3-pyridinyl]pyridine |
|---|---|
| PubChem CID | 59629353 |
| Molecular Formula | C34H24N2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-(3-phenylphenyl)-5-[6-(3-phenylphenyl)-3-pyridinyl]pyridine |
| SMILES | c1ccc(-c2cccc(-c3ccc(-c4ccc(-c5cccc(-c6ccccc6)c5)nc4)cn3)c2)cc1 |
| InChI | InChI=1S/C34H24N2/c1-3-9-25(10-4-1)27-13-7-15-29(21-27)33-19-17-31(23-35-33)32-18-20-34(36-24-32)30-16-8-14-28(22-30)26-11-5-2-6-12-26/h1-24H |
| InChIKey | APEKTNQKGLWKQX-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |