C48H32N2O8S — CID 59629978
2-methyl-5-[4-[2-[4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]phenyl]isoindole-1,3-dione (PubChem CID 59629978) has the molecular formula C48H32N2O8S and a molecular weight of 796.86 g/mol. Its IUPAC name is 2-methyl-5-[4-[2-[4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[4-[2-[4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 59629978 |
| Molecular Formula | C48H32N2O8S |
| Molecular Weight | 796.86 g/mol |
| Exact Mass | 796.19 |
| IUPAC Name | 2-methyl-5-[4-[2-[4-[4-[4-(4-methylphenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]phenyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N5C(=O)c6ccc(-c7ccc(-c8ccc9c(c8)C(=O)N(C)C9=O)cc7)cc6C5=O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C48H32N2O8S/c1-29-3-13-35(14-4-29)57-37-17-21-39(22-18-37)59(55,56)40-23-19-38(20-24-40)58-36-15-11-34(12-16-36)50-47(53)42-26-10-33(28-44(42)48(50)54)31-7-5-30(6-8-31)32-9-25-41-43(27-32)46(52)49(2)45(41)51/h3-28H,1-2H3 |
| InChIKey | PQXFKEDJKHKKNW-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.86 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|