About CID 59630137
CID 59630137 (PubChem CID 59630137) has the molecular formula C5H10N3
and a molecular weight of 112.16 g/mol.
Molecular Properties
| Compound Name | CID 59630137 |
| PubChem CID | 59630137 |
| Molecular Formula | C5H10N3 |
| Molecular Weight | 112.16 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\N)N1[CH]CCC1 |
| InChI | InChI=1S/C5H10N3/c6-5(7)8-3-1-2-4-8/h3H,1-2,4H2,(H3,6,7) |
| InChIKey | JKTBHONGHWYUHS-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.16 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 59630137 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59630137?
The IUPAC name of CID 59630137 (CID 59630137) is not available.
What is the SMILES notation for CID 59630137?
The canonical SMILES for CID 59630137 is [H]/N=C(\N)N1[CH]CCC1.
What is the InChIKey of CID 59630137?
The InChIKey is JKTBHONGHWYUHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N3/c6-5(7)8-3-1-2-4-8/h3H,1-2,4H2,(H3,6,7).
What are the key properties of CID 59630137?
CID 59630137 has a molecular weight of 112.16 g/mol, XLogP of 0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59630137 is sourced from PubChem (CID 59630137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).