About 1-adamantyl 4-methylbenzoate
1-adamantyl 4-methylbenzoate (PubChem CID 59630373) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-adamantyl 4-methylbenzoate.
Molecular Properties
| Compound Name | 1-adamantyl 4-methylbenzoate |
| PubChem CID | 59630373 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-adamantyl 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H22O2/c1-12-2-4-16(5-3-12)17(19)20-18-9-13-6-14(10-18)8-15(7-13)11-18/h2-5,13-15H,6-11H2,1H3 |
| InChIKey | NBSSEPSGDTZMGW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantyl 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl 4-methylbenzoate?
The IUPAC name of 1-adamantyl 4-methylbenzoate (CID 59630373) is 1-adamantyl 4-methylbenzoate.
What is the SMILES notation for 1-adamantyl 4-methylbenzoate?
The canonical SMILES for 1-adamantyl 4-methylbenzoate is Cc1ccc(C(=O)OC23CC4CC(CC(C4)C2)C3)cc1.
What is the InChIKey of 1-adamantyl 4-methylbenzoate?
The InChIKey is NBSSEPSGDTZMGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2/c1-12-2-4-16(5-3-12)17(19)20-18-9-13-6-14(10-18)8-15(7-13)11-18/h2-5,13-15H,6-11H2,1H3.
What are the key properties of 1-adamantyl 4-methylbenzoate?
1-adamantyl 4-methylbenzoate has a molecular weight of 270.37 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl 4-methylbenzoate is sourced from PubChem (CID 59630373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).