C24H39N2+ — CID 59630387
3-(4-tert-butyl-4,5,5,6-tetramethyl-6-phenylheptyl)-1H-imidazol-3-ium (PubChem CID 59630387) has the molecular formula C24H39N2+ and a molecular weight of 355.59 g/mol. Its IUPAC name is 3-(4-tert-butyl-4,5,5,6-tetramethyl-6-phenylheptyl)-1H-imidazol-3-ium.
| Compound Name | 3-(4-tert-butyl-4,5,5,6-tetramethyl-6-phenylheptyl)-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 59630387 |
| Molecular Formula | C24H39N2+ |
| Molecular Weight | 355.59 g/mol |
| Exact Mass | 355.31 |
| IUPAC Name | 3-(4-tert-butyl-4,5,5,6-tetramethyl-6-phenylheptyl)-1H-imidazol-3-ium |
| SMILES | CC(C)(C)C(C)(CCC[n+]1cc[nH]c1)C(C)(C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H38N2/c1-21(2,3)24(8,15-12-17-26-18-16-25-19-26)23(6,7)22(4,5)20-13-10-9-11-14-20/h9-11,13-14,16,18-19H,12,15,17H2,1-8H3/p+1 |
| InChIKey | OUHFWMJBEXOETM-UHFFFAOYSA-O |
| XLogP | 6.14 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|