About dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane
dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane (PubChem CID 59630466) has the molecular formula C13H19N3O2Si
and a molecular weight of 277.40 g/mol. Its IUPAC name is dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane.
Molecular Properties
| Compound Name | dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane |
| PubChem CID | 59630466 |
| Molecular Formula | C13H19N3O2Si |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane |
| SMILES | CO[Si](CCCn1cncn1)(OC)c1ccccc1 |
| InChI | InChI=1S/C13H19N3O2Si/c1-17-19(18-2,13-7-4-3-5-8-13)10-6-9-16-12-14-11-15-16/h3-5,7-8,11-12H,6,9-10H2,1-2H3 |
| InChIKey | SKJYFINOHYSVOH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane?
The IUPAC name of dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane (CID 59630466) is dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane.
What is the SMILES notation for dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane?
The canonical SMILES for dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane is CO[Si](CCCn1cncn1)(OC)c1ccccc1.
What is the InChIKey of dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane?
The InChIKey is SKJYFINOHYSVOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2Si/c1-17-19(18-2,13-7-4-3-5-8-13)10-6-9-16-12-14-11-15-16/h3-5,7-8,11-12H,6,9-10H2,1-2H3.
What are the key properties of dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane?
dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane has a molecular weight of 277.40 g/mol, XLogP of 1.31, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-phenyl-[3-(1,2,4-triazol-1-yl)propyl]silane is sourced from PubChem (CID 59630466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).