C19H31NO2Si — CID 59630499
3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)propyl-dimethoxy-phenylsilane (PubChem CID 59630499) has the molecular formula C19H31NO2Si and a molecular weight of 333.55 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)propyl-dimethoxy-phenylsilane.
| Compound Name | 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)propyl-dimethoxy-phenylsilane |
|---|---|
| PubChem CID | 59630499 |
| Molecular Formula | C19H31NO2Si |
| Molecular Weight | 333.55 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-3-yl)propyl-dimethoxy-phenylsilane |
| SMILES | CO[Si](CCCC1CNC2CCCCC12)(OC)c1ccccc1 |
| InChI | InChI=1S/C19H31NO2Si/c1-21-23(22-2,17-10-4-3-5-11-17)14-8-9-16-15-20-19-13-7-6-12-18(16)19/h3-5,10-11,16,18-20H,6-9,12-15H2,1-2H3 |
| InChIKey | XKXFFOBKJGUIPL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|