C7H14O5 — CID 59630573
(1R,2S,4R,5S)-6-methylcyclohexane-1,2,3,4,5-pentol (PubChem CID 59630573) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is (1R,2S,4R,5S)-6-methylcyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1R,2S,4R,5S)-6-methylcyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 59630573 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (1R,2S,4R,5S)-6-methylcyclohexane-1,2,3,4,5-pentol |
| SMILES | CC1[C@@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C7H14O5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h2-12H,1H3/t2?,3-,4+,5+,6-,7? |
| InChIKey | UYKMYUPVWOASSL-MVWKSXLKSA-N |
| XLogP | -2.56 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |