C18H27N4O14P- — CID 59630581
CID 59630581 (PubChem CID 59630581) has the molecular formula C18H27N4O14P- and a molecular weight of 555.41 g/mol.
| Compound Name | CID 59630581 |
|---|---|
| PubChem CID | 59630581 |
| Molecular Formula | C18H27N4O14P- |
| Molecular Weight | 555.41 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | — |
| SMILES | [2H]CC(O)C(O)C1OC(OP(=O)([O-])OCC2OC(n3ccc(N)nc3=O)C(O)C2O)(C(=O)O)CC(O)C1[NH] |
| InChI | InChI=1S/C18H28N4O14P/c1-6(23)11(25)14-10(20)7(24)4-18(35-14,16(28)29)36-37(31,32)33-5-8-12(26)13(27)15(34-8)22-3-2-9(19)21-17(22)30/h2-3,6-8,10-15,20,23-27H,4-5H2,1H3,(H,28,29)(H,31,32)(H2,19,21,30)/p-1/i1D |
| InChIKey | JQCMHIMHKHKHKE-MICDWDOJSA-M |
| XLogP | -4.73 |
| TPSA | 300.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.41 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|