C13H21FN2S — CID 59630961
2-tert-butyl-4-fluoro-5-propyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 59630961) has the molecular formula C13H21FN2S and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-tert-butyl-4-fluoro-5-propyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 2-tert-butyl-4-fluoro-5-propyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 59630961 |
| Molecular Formula | C13H21FN2S |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 2-tert-butyl-4-fluoro-5-propyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | CCCN1CCc2sc(C(C)(C)C)nc2C1F |
| InChI | InChI=1S/C13H21FN2S/c1-5-7-16-8-6-9-10(11(16)14)15-12(17-9)13(2,3)4/h11H,5-8H2,1-4H3 |
| InChIKey | WSVYTAOPAQWCPZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|