About tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate
tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate (PubChem CID 59631055) has the molecular formula C19H22ClF2N3O2
and a molecular weight of 397.85 g/mol. Its IUPAC name is tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate |
| PubChem CID | 59631055 |
| Molecular Formula | C19H22ClF2N3O2 |
| Molecular Weight | 397.85 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate |
| SMILES | Cc1c(N2CCN(C(=O)OC(C)(C)C)CC2)nc2cc(F)cc(F)c2c1Cl |
| InChI | InChI=1S/C19H22ClF2N3O2/c1-11-16(20)15-13(22)9-12(21)10-14(15)23-17(11)24-5-7-25(8-6-24)18(26)27-19(2,3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | LXCLIGZPJLFHAC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.85 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate (CID 59631055) is tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate is Cc1c(N2CCN(C(=O)OC(C)(C)C)CC2)nc2cc(F)cc(F)c2c1Cl.
What is the InChIKey of tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate?
The InChIKey is LXCLIGZPJLFHAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClF2N3O2/c1-11-16(20)15-13(22)9-12(21)10-14(15)23-17(11)24-5-7-25(8-6-24)18(26)27-19(2,3)4/h9-10H,5-8H2,1-4H3.
What are the key properties of tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate?
tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate has a molecular weight of 397.85 g/mol, XLogP of 4.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)piperazine-1-carboxylate is sourced from PubChem (CID 59631055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).