C28H27ClF2N6O2 — CID 59631140
8-chloro-N-(2,5-dimorpholin-4-yl-3-pyridinyl)-5,7-difluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine (PubChem CID 59631140) has the molecular formula C28H27ClF2N6O2 and a molecular weight of 553.01 g/mol. Its IUPAC name is 8-chloro-N-(2,5-dimorpholin-4-yl-3-pyridinyl)-5,7-difluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine.
| Compound Name | 8-chloro-N-(2,5-dimorpholin-4-yl-3-pyridinyl)-5,7-difluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine |
|---|---|
| PubChem CID | 59631140 |
| Molecular Formula | C28H27ClF2N6O2 |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 8-chloro-N-(2,5-dimorpholin-4-yl-3-pyridinyl)-5,7-difluoro-3-methyl-2-pyridin-2-ylquinolin-4-amine |
| SMILES | Cc1c(-c2ccccn2)nc2c(Cl)c(F)cc(F)c2c1Nc1cc(N2CCOCC2)cnc1N1CCOCC1 |
| InChI | InChI=1S/C28H27ClF2N6O2/c1-17-25(21-4-2-3-5-32-21)35-27-23(19(30)15-20(31)24(27)29)26(17)34-22-14-18(36-6-10-38-11-7-36)16-33-28(22)37-8-12-39-13-9-37/h2-5,14-16H,6-13H2,1H3,(H,34,35) |
| InChIKey | JNVOSLRPHVSDCC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|