C29H28F2N6O4 — CID 59631298
N-(2,5-dimorpholin-4-yl-3-pyridinyl)-7-fluoro-2-(2-fluoro-5-nitrophenyl)-3-methylquinolin-4-amine (PubChem CID 59631298) has the molecular formula C29H28F2N6O4 and a molecular weight of 562.58 g/mol. Its IUPAC name is N-(2,5-dimorpholin-4-yl-3-pyridinyl)-7-fluoro-2-(2-fluoro-5-nitrophenyl)-3-methylquinolin-4-amine.
| Compound Name | N-(2,5-dimorpholin-4-yl-3-pyridinyl)-7-fluoro-2-(2-fluoro-5-nitrophenyl)-3-methylquinolin-4-amine |
|---|---|
| PubChem CID | 59631298 |
| Molecular Formula | C29H28F2N6O4 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | N-(2,5-dimorpholin-4-yl-3-pyridinyl)-7-fluoro-2-(2-fluoro-5-nitrophenyl)-3-methylquinolin-4-amine |
| SMILES | Cc1c(-c2cc([N+](=O)[O-])ccc2F)nc2cc(F)ccc2c1Nc1cc(N2CCOCC2)cnc1N1CCOCC1 |
| InChI | InChI=1S/C29H28F2N6O4/c1-18-27(22-4-2-19(30)14-25(22)33-28(18)23-15-20(37(38)39)3-5-24(23)31)34-26-16-21(35-6-10-40-11-7-35)17-32-29(26)36-8-12-41-13-9-36/h2-5,14-17H,6-13H2,1H3,(H,33,34) |
| InChIKey | NVVZDQIMFJRIFZ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|