About tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate
tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate (PubChem CID 59631367) has the molecular formula C20H24ClF2N3O2
and a molecular weight of 411.88 g/mol. Its IUPAC name is tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate |
| PubChem CID | 59631367 |
| Molecular Formula | C20H24ClF2N3O2 |
| Molecular Weight | 411.88 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate |
| SMILES | Cc1c(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)nc2cc(F)cc(F)c2c1Cl |
| InChI | InChI=1S/C20H24ClF2N3O2/c1-11-10-25(19(27)28-20(3,4)5)6-7-26(11)18-12(2)17(21)16-14(23)8-13(22)9-15(16)24-18/h8-9,11H,6-7,10H2,1-5H3/t11-/m0/s1 |
| InChIKey | NXJVGPSKNMKCJQ-NSHDSACASA-N |
| XLogP | 4.92 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.88 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate?
The IUPAC name of tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate (CID 59631367) is tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate.
What is the SMILES notation for tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate?
The canonical SMILES for tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate is Cc1c(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)nc2cc(F)cc(F)c2c1Cl.
What is the InChIKey of tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate?
The InChIKey is NXJVGPSKNMKCJQ-NSHDSACASA-N. The full InChI is InChI=1S/C20H24ClF2N3O2/c1-11-10-25(19(27)28-20(3,4)5)6-7-26(11)18-12(2)17(21)16-14(23)8-13(22)9-15(16)24-18/h8-9,11H,6-7,10H2,1-5H3/t11-/m0/s1.
What are the key properties of tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate?
tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate has a molecular weight of 411.88 g/mol, XLogP of 4.92, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-4-(4-chloro-5,7-difluoro-3-methylquinolin-2-yl)-3-methylpiperazine-1-carboxylate is sourced from PubChem (CID 59631367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).