C10H9BrN2O3 — CID 59631376
5-bromo-2-(3,6-dihydro-2H-pyran-4-yl)-3-nitropyridine (PubChem CID 59631376) has the molecular formula C10H9BrN2O3 and a molecular weight of 285.10 g/mol. Its IUPAC name is 5-bromo-2-(3,6-dihydro-2H-pyran-4-yl)-3-nitropyridine.
| Compound Name | 5-bromo-2-(3,6-dihydro-2H-pyran-4-yl)-3-nitropyridine |
|---|---|
| PubChem CID | 59631376 |
| Molecular Formula | C10H9BrN2O3 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 5-bromo-2-(3,6-dihydro-2H-pyran-4-yl)-3-nitropyridine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1C1=CCOCC1 |
| InChI | InChI=1S/C10H9BrN2O3/c11-8-5-9(13(14)15)10(12-6-8)7-1-3-16-4-2-7/h1,5-6H,2-4H2 |
| InChIKey | JBDFCGMOQZSZNX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|