C21H18F3N3O2S2 — CID 59631768
(Z)-4,4,4-trifluoro-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(pyridin-2-ylmethylimino)but-1-en-1-amine (PubChem CID 59631768) has the molecular formula C21H18F3N3O2S2 and a molecular weight of 465.52 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(pyridin-2-ylmethylimino)but-1-en-1-amine.
| Compound Name | (Z)-4,4,4-trifluoro-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(pyridin-2-ylmethylimino)but-1-en-1-amine |
|---|---|
| PubChem CID | 59631768 |
| Molecular Formula | C21H18F3N3O2S2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | (Z)-4,4,4-trifluoro-1-[5-(3-methylsulfonylphenyl)thiophen-2-yl]-3-(pyridin-2-ylmethylimino)but-1-en-1-amine |
| SMILES | CS(=O)(=O)c1cccc(-c2ccc(/C(N)=C/C(=N/Cc3ccccn3)C(F)(F)F)s2)c1 |
| InChI | InChI=1S/C21H18F3N3O2S2/c1-31(28,29)16-7-4-5-14(11-16)18-8-9-19(30-18)17(25)12-20(21(22,23)24)27-13-15-6-2-3-10-26-15/h2-12H,13,25H2,1H3/b17-12-,27-20- |
| InChIKey | TWQUXCBDHQCGGE-GOXNSVPTSA-N |
| XLogP | 4.72 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|