C21H21ClF3N3O2 — CID 59631785
4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]-N-(2-hydroxybutyl)benzamide (PubChem CID 59631785) has the molecular formula C21H21ClF3N3O2 and a molecular weight of 439.87 g/mol. Its IUPAC name is 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]-N-(2-hydroxybutyl)benzamide.
| Compound Name | 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]-N-(2-hydroxybutyl)benzamide |
|---|---|
| PubChem CID | 59631785 |
| Molecular Formula | C21H21ClF3N3O2 |
| Molecular Weight | 439.87 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]-N-(2-hydroxybutyl)benzamide |
| SMILES | CCC(O)CNC(=O)c1ccc(C(/C=C(\N)C(F)(F)F)=N/c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H21ClF3N3O2/c1-2-15(29)12-27-20(30)14-9-7-13(8-10-14)18(11-19(26)21(23,24)25)28-17-6-4-3-5-16(17)22/h3-11,15,29H,2,12,26H2,1H3,(H,27,30)/b19-11-,28-18+ |
| InChIKey | CCMVLDTZYPTDQH-ZNLWDIEVSA-N |
| XLogP | 4.37 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.87 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|