C18H15ClF3N3O — CID 59631810
4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]-N-methylbenzamide (PubChem CID 59631810) has the molecular formula C18H15ClF3N3O and a molecular weight of 381.79 g/mol. Its IUPAC name is 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]-N-methylbenzamide.
| Compound Name | 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 59631810 |
| Molecular Formula | C18H15ClF3N3O |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-[C-[(Z)-2-amino-3,3,3-trifluoroprop-1-enyl]-N-(2-chlorophenyl)carbonimidoyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(C(/C=C(\N)C(F)(F)F)=N/c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C18H15ClF3N3O/c1-24-17(26)12-8-6-11(7-9-12)15(10-16(23)18(20,21)22)25-14-5-3-2-4-13(14)19/h2-10H,23H2,1H3,(H,24,26)/b16-10-,25-15+ |
| InChIKey | RFEFCLQVGQQOMI-LGFKRGROSA-N |
| XLogP | 4.23 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|