C21H15ClF3N3O2S — CID 59632448
4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(2-oxothiolan-3-yl)benzamide (PubChem CID 59632448) has the molecular formula C21H15ClF3N3O2S and a molecular weight of 465.88 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(2-oxothiolan-3-yl)benzamide.
| Compound Name | 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(2-oxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 59632448 |
| Molecular Formula | C21H15ClF3N3O2S |
| Molecular Weight | 465.88 g/mol |
| Exact Mass | 465.05 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(2-oxothiolan-3-yl)benzamide |
| SMILES | O=C(NC1CCSC1=O)c1ccc(-c2cc(C(F)(F)F)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H15ClF3N3O2S/c22-14-3-1-2-4-16(14)28-17(11-18(27-28)21(23,24)25)12-5-7-13(8-6-12)19(29)26-15-9-10-31-20(15)30/h1-8,11,15H,9-10H2,(H,26,29) |
| InChIKey | OHAAYOJSAAYRIN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.88 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|