C24H17ClF3N3O2 — CID 59632508
4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(4-hydroxy-3-methylphenyl)benzamide (PubChem CID 59632508) has the molecular formula C24H17ClF3N3O2 and a molecular weight of 471.87 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(4-hydroxy-3-methylphenyl)benzamide.
| Compound Name | 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(4-hydroxy-3-methylphenyl)benzamide |
|---|---|
| PubChem CID | 59632508 |
| Molecular Formula | C24H17ClF3N3O2 |
| Molecular Weight | 471.87 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-3-(trifluoromethyl)pyrazol-5-yl]-N-(4-hydroxy-3-methylphenyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(-c3cc(C(F)(F)F)nn3-c3ccccc3Cl)cc2)ccc1O |
| InChI | InChI=1S/C24H17ClF3N3O2/c1-14-12-17(10-11-21(14)32)29-23(33)16-8-6-15(7-9-16)20-13-22(24(26,27)28)30-31(20)19-5-3-2-4-18(19)25/h2-13,32H,1H3,(H,29,33) |
| InChIKey | VXYBWBLPSWVLSZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.87 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|